About ethyl 2-butoxyacetate
ethyl 2-butoxyacetate (PubChem CID 14419651) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is ethyl 2-butoxyacetate.
Molecular Properties
| Compound Name | ethyl 2-butoxyacetate |
| PubChem CID | 14419651 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | ethyl 2-butoxyacetate |
| SMILES | CCCCOCC(=O)OCC |
| InChI | InChI=1S/C8H16O3/c1-3-5-6-10-7-8(9)11-4-2/h3-7H2,1-2H3 |
| InChIKey | SVBSJWKYFYUHTF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-butoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-butoxyacetate?
The IUPAC name of ethyl 2-butoxyacetate (CID 14419651) is ethyl 2-butoxyacetate.
What is the SMILES notation for ethyl 2-butoxyacetate?
The canonical SMILES for ethyl 2-butoxyacetate is CCCCOCC(=O)OCC.
What is the InChIKey of ethyl 2-butoxyacetate?
The InChIKey is SVBSJWKYFYUHTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-3-5-6-10-7-8(9)11-4-2/h3-7H2,1-2H3.
What are the key properties of ethyl 2-butoxyacetate?
ethyl 2-butoxyacetate has a molecular weight of 160.21 g/mol, XLogP of 1.37, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-butoxyacetate is sourced from PubChem (CID 14419651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).