About 5,5-dioxodibenzothiophene-2,8-diol
5,5-dioxodibenzothiophene-2,8-diol (PubChem CID 14419775) has the molecular formula C12H8O4S
and a molecular weight of 248.26 g/mol. Its IUPAC name is 5,5-dioxodibenzothiophene-2,8-diol.
Molecular Properties
| Compound Name | 5,5-dioxodibenzothiophene-2,8-diol |
| PubChem CID | 14419775 |
| Molecular Formula | C12H8O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 5,5-dioxodibenzothiophene-2,8-diol |
| SMILES | O=S1(=O)c2ccc(O)cc2-c2cc(O)ccc21 |
| InChI | InChI=1S/C12H8O4S/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)17(11,15)16/h1-6,13-14H |
| InChIKey | KLCDHEZIXURIDW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,5-dioxodibenzothiophene-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dioxodibenzothiophene-2,8-diol?
The IUPAC name of 5,5-dioxodibenzothiophene-2,8-diol (CID 14419775) is 5,5-dioxodibenzothiophene-2,8-diol.
What is the SMILES notation for 5,5-dioxodibenzothiophene-2,8-diol?
The canonical SMILES for 5,5-dioxodibenzothiophene-2,8-diol is O=S1(=O)c2ccc(O)cc2-c2cc(O)ccc21.
What is the InChIKey of 5,5-dioxodibenzothiophene-2,8-diol?
The InChIKey is KLCDHEZIXURIDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O4S/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)17(11,15)16/h1-6,13-14H.
What are the key properties of 5,5-dioxodibenzothiophene-2,8-diol?
5,5-dioxodibenzothiophene-2,8-diol has a molecular weight of 248.26 g/mol, XLogP of 1.91, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dioxodibenzothiophene-2,8-diol is sourced from PubChem (CID 14419775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).