(E)-oct-4-ene-4-sulfonic acid

C8H16O3S — CID 14419923

IUPAC(E)-oct-4-ene-4-sulfonic acid
SMILESCCC/C=C(\CCC)S(=O)(=O)O
InChIInChI=1S/C8H16O3S/c1-3-5-7-8(6-4-2)12(9,10)11/h7H,3-6H2,1-2H3,(H,9,10,11)/b8-7+
InChIKeyRBVVZKPPKQRZJK-BQYQJAHWSA-N
MW192.28 g/mol
LogP2.36
Rot. Bonds5

About (E)-oct-4-ene-4-sulfonic acid

(E)-oct-4-ene-4-sulfonic acid (PubChem CID 14419923) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is (E)-oct-4-ene-4-sulfonic acid.

Molecular Properties

Compound Name(E)-oct-4-ene-4-sulfonic acid
PubChem CID14419923
Molecular FormulaC8H16O3S
Molecular Weight192.28 g/mol
Exact Mass192.08
IUPAC Name(E)-oct-4-ene-4-sulfonic acid
SMILESCCC/C=C(\CCC)S(=O)(=O)O
InChIInChI=1S/C8H16O3S/c1-3-5-7-8(6-4-2)12(9,10)11/h7H,3-6H2,1-2H3,(H,9,10,11)/b8-7+
InChIKeyRBVVZKPPKQRZJK-BQYQJAHWSA-N
XLogP2.36
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.28
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (E)-oct-4-ene-4-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-oct-4-ene-4-sulfonic acid?
The IUPAC name of (E)-oct-4-ene-4-sulfonic acid (CID 14419923) is (E)-oct-4-ene-4-sulfonic acid.
What is the SMILES notation for (E)-oct-4-ene-4-sulfonic acid?
The canonical SMILES for (E)-oct-4-ene-4-sulfonic acid is CCC/C=C(\CCC)S(=O)(=O)O.
What is the InChIKey of (E)-oct-4-ene-4-sulfonic acid?
The InChIKey is RBVVZKPPKQRZJK-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H16O3S/c1-3-5-7-8(6-4-2)12(9,10)11/h7H,3-6H2,1-2H3,(H,9,10,11)/b8-7+.
What are the key properties of (E)-oct-4-ene-4-sulfonic acid?
(E)-oct-4-ene-4-sulfonic acid has a molecular weight of 192.28 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-oct-4-ene-4-sulfonic acid is sourced from PubChem (CID 14419923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).