About 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid
7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid (PubChem CID 1442) has the molecular formula C20H32O5
and a molecular weight of 352.47 g/mol. Its IUPAC name is 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid.
Molecular Properties
| Compound Name | 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid |
| PubChem CID | 1442 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(=O)C=CC1C(O)CC(O)C1CC=CCCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,16-19,22-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25) |
| InChIKey | LOLJEILMPWPILA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid?
The IUPAC name of 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid (CID 1442) is 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid.
What is the SMILES notation for 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid?
The canonical SMILES for 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid is CCCCCC(=O)C=CC1C(O)CC(O)C1CC=CCCCC(=O)O.
What is the InChIKey of 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid?
The InChIKey is LOLJEILMPWPILA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,16-19,22-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25).
What are the key properties of 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid?
7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid has a molecular weight of 352.47 g/mol, XLogP of 3.25, 12 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3,5-dihydroxy-2-(3-oxooct-1-enyl)cyclopentyl]hept-5-enoic acid is sourced from PubChem (CID 1442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).