About methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate
methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate (PubChem CID 14421313) has the molecular formula C12H9Cl2N3O3
and a molecular weight of 314.13 g/mol. Its IUPAC name is methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate |
| PubChem CID | 14421313 |
| Molecular Formula | C12H9Cl2N3O3 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(-c2cc(Cl)cc(Cl)c2)c1C(N)=O |
| InChI | InChI=1S/C12H9Cl2N3O3/c1-20-12(19)9-5-16-17(10(9)11(15)18)8-3-6(13)2-7(14)4-8/h2-5H,1H3,(H2,15,18) |
| InChIKey | UFJQVVUYCFHXFE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate?
The IUPAC name of methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate (CID 14421313) is methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate.
What is the SMILES notation for methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate?
The canonical SMILES for methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate is COC(=O)c1cnn(-c2cc(Cl)cc(Cl)c2)c1C(N)=O.
What is the InChIKey of methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate?
The InChIKey is UFJQVVUYCFHXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2N3O3/c1-20-12(19)9-5-16-17(10(9)11(15)18)8-3-6(13)2-7(14)4-8/h2-5H,1H3,(H2,15,18).
What are the key properties of methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate?
methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate has a molecular weight of 314.13 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-carbamoyl-1-(3,5-dichlorophenyl)pyrazole-4-carboxylate is sourced from PubChem (CID 14421313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).