About 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide
2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 14422447) has the molecular formula C9H11N3O2S2
and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide |
| PubChem CID | 14422447 |
| Molecular Formula | C9H11N3O2S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CCSc1nc2ccccn2c1S(N)(=O)=O |
| InChI | InChI=1S/C9H11N3O2S2/c1-2-15-8-9(16(10,13)14)12-6-4-3-5-7(12)11-8/h3-6H,2H2,1H3,(H2,10,13,14) |
| InChIKey | FPJRBSCZMAJEEE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide?
The IUPAC name of 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide (CID 14422447) is 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide.
What is the SMILES notation for 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide?
The canonical SMILES for 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide is CCSc1nc2ccccn2c1S(N)(=O)=O.
What is the InChIKey of 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide?
The InChIKey is FPJRBSCZMAJEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2S2/c1-2-15-8-9(16(10,13)14)12-6-4-3-5-7(12)11-8/h3-6H,2H2,1H3,(H2,10,13,14).
What are the key properties of 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide?
2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide has a molecular weight of 257.34 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanylimidazo[1,2-a]pyridine-3-sulfonamide is sourced from PubChem (CID 14422447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).