About 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide
5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide (PubChem CID 14422514) has the molecular formula C8H10N4O2S
and a molecular weight of 226.26 g/mol. Its IUPAC name is 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide.
Molecular Properties
| Compound Name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide |
| PubChem CID | 14422514 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide |
| SMILES | Cc1cc(C)n2ncc(S(N)(=O)=O)c2n1 |
| InChI | InChI=1S/C8H10N4O2S/c1-5-3-6(2)12-8(11-5)7(4-10-12)15(9,13)14/h3-4H,1-2H3,(H2,9,13,14) |
| InChIKey | QOTMAIJKWDDBJN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide?
The IUPAC name of 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide (CID 14422514) is 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide.
What is the SMILES notation for 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide?
The canonical SMILES for 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide is Cc1cc(C)n2ncc(S(N)(=O)=O)c2n1.
What is the InChIKey of 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide?
The InChIKey is QOTMAIJKWDDBJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2S/c1-5-3-6(2)12-8(11-5)7(4-10-12)15(9,13)14/h3-4H,1-2H3,(H2,9,13,14).
What are the key properties of 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide?
5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide has a molecular weight of 226.26 g/mol, XLogP of -0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-sulfonamide is sourced from PubChem (CID 14422514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).