C27H50O6Si — CID 14422794
(6E)-8-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-5-(methoxymethoxy)-4,6-dimethylocta-1,6-dien-3-ol (PubChem CID 14422794) has the molecular formula C27H50O6Si and a molecular weight of 498.78 g/mol. Its IUPAC name is (6E)-8-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-5-(methoxymethoxy)-4,6-dimethylocta-1,6-dien-3-ol.
| Compound Name | (6E)-8-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-5-(methoxymethoxy)-4,6-dimethylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 14422794 |
| Molecular Formula | C27H50O6Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | (6E)-8-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-5-(methoxymethoxy)-4,6-dimethylocta-1,6-dien-3-ol |
| SMILES | C=CC(O)C(C)C(OCOC)/C(C)=C/CC1CC(O[Si](C)(C)C(C)(C)C)CC2(CCCCO2)O1 |
| InChI | InChI=1S/C27H50O6Si/c1-10-24(28)21(3)25(30-19-29-7)20(2)13-14-22-17-23(33-34(8,9)26(4,5)6)18-27(32-22)15-11-12-16-31-27/h10,13,21-25,28H,1,11-12,14-19H2,2-9H3/b20-13+ |
| InChIKey | DBWUKJMEAKDAJA-DEDYPNTBSA-N |
| XLogP | 5.96 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|