C36H36N2O8 — CID 14422820
[8-cyano-2-(8-cyano-6,7-dihydroxy-3-methyl-1-propanoyloxy-5-propan-2-ylnaphthalen-2-yl)-6,7-dihydroxy-3-methyl-5-propan-2-ylnaphthalen-1-yl] propanoate (PubChem CID 14422820) has the molecular formula C36H36N2O8 and a molecular weight of 624.69 g/mol. Its IUPAC name is [8-cyano-2-(8-cyano-6,7-dihydroxy-3-methyl-1-propanoyloxy-5-propan-2-ylnaphthalen-2-yl)-6,7-dihydroxy-3-methyl-5-propan-2-ylnaphthalen-1-yl] propanoate.
| Compound Name | [8-cyano-2-(8-cyano-6,7-dihydroxy-3-methyl-1-propanoyloxy-5-propan-2-ylnaphthalen-2-yl)-6,7-dihydroxy-3-methyl-5-propan-2-ylnaphthalen-1-yl] propanoate |
|---|---|
| PubChem CID | 14422820 |
| Molecular Formula | C36H36N2O8 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | [8-cyano-2-(8-cyano-6,7-dihydroxy-3-methyl-1-propanoyloxy-5-propan-2-ylnaphthalen-2-yl)-6,7-dihydroxy-3-methyl-5-propan-2-ylnaphthalen-1-yl] propanoate |
| SMILES | CCC(=O)Oc1c(-c2c(C)cc3c(C(C)C)c(O)c(O)c(C#N)c3c2OC(=O)CC)c(C)cc2c(C(C)C)c(O)c(O)c(C#N)c12 |
| InChI | InChI=1S/C36H36N2O8/c1-9-23(39)45-35-27(17(7)11-19-25(15(3)4)33(43)31(41)21(13-37)29(19)35)28-18(8)12-20-26(16(5)6)34(44)32(42)22(14-38)30(20)36(28)46-24(40)10-2/h11-12,15-16,41-44H,9-10H2,1-8H3 |
| InChIKey | AAVOEDYCRXZYKX-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 181.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|