About (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol
(4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol (PubChem CID 14423021) has the molecular formula C9H4F4O
and a molecular weight of 204.12 g/mol. Its IUPAC name is (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol.
Molecular Properties
| Compound Name | (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol |
| PubChem CID | 14423021 |
| Molecular Formula | C9H4F4O |
| Molecular Weight | 204.12 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol |
| SMILES | C#Cc1c(F)c(F)c(CO)c(F)c1F |
| InChI | InChI=1S/C9H4F4O/c1-2-4-6(10)8(12)5(3-14)9(13)7(4)11/h1,14H,3H2 |
| InChIKey | BNPWGHGYEZCYOD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.12 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol?
The IUPAC name of (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol (CID 14423021) is (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol.
What is the SMILES notation for (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol?
The canonical SMILES for (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol is C#Cc1c(F)c(F)c(CO)c(F)c1F.
What is the InChIKey of (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol?
The InChIKey is BNPWGHGYEZCYOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F4O/c1-2-4-6(10)8(12)5(3-14)9(13)7(4)11/h1,14H,3H2.
What are the key properties of (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol?
(4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol has a molecular weight of 204.12 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethynyl-2,3,5,6-tetrafluorophenyl)methanol is sourced from PubChem (CID 14423021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).