C10H10F4N2O — CID 14423025
[2,3,5,6-tetrafluoro-4-(2-propan-2-ylidenehydrazinyl)phenyl]methanol (PubChem CID 14423025) has the molecular formula C10H10F4N2O and a molecular weight of 250.19 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(2-propan-2-ylidenehydrazinyl)phenyl]methanol.
| Compound Name | [2,3,5,6-tetrafluoro-4-(2-propan-2-ylidenehydrazinyl)phenyl]methanol |
|---|---|
| PubChem CID | 14423025 |
| Molecular Formula | C10H10F4N2O |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(2-propan-2-ylidenehydrazinyl)phenyl]methanol |
| SMILES | CC(C)=NNc1c(F)c(F)c(CO)c(F)c1F |
| InChI | InChI=1S/C10H10F4N2O/c1-4(2)15-16-10-8(13)6(11)5(3-17)7(12)9(10)14/h16-17H,3H2,1-2H3 |
| InChIKey | OGFPKCIRHFXBGV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|