C11H8F4O2 — CID 14423031
[2,3,5,6-tetrafluoro-4-(prop-2-ynoxymethyl)phenyl]methanol (PubChem CID 14423031) has the molecular formula C11H8F4O2 and a molecular weight of 248.17 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(prop-2-ynoxymethyl)phenyl]methanol.
| Compound Name | [2,3,5,6-tetrafluoro-4-(prop-2-ynoxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 14423031 |
| Molecular Formula | C11H8F4O2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(prop-2-ynoxymethyl)phenyl]methanol |
| SMILES | C#CCOCc1c(F)c(F)c(CO)c(F)c1F |
| InChI | InChI=1S/C11H8F4O2/c1-2-3-17-5-7-10(14)8(12)6(4-16)9(13)11(7)15/h1,16H,3-5H2 |
| InChIKey | QWRZJAUMDYBTCG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|