C16H11Cl2N3O — CID 14423222
2-(3,4-dichlorophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one (PubChem CID 14423222) has the molecular formula C16H11Cl2N3O and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one.
| Compound Name | 2-(3,4-dichlorophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one |
|---|---|
| PubChem CID | 14423222 |
| Molecular Formula | C16H11Cl2N3O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one |
| SMILES | O=c1c2c(n(-c3ccc(Cl)c(Cl)c3)c3nccnc13)CCC2 |
| InChI | InChI=1S/C16H11Cl2N3O/c17-11-5-4-9(8-12(11)18)21-13-3-1-2-10(13)15(22)14-16(21)20-7-6-19-14/h4-8H,1-3H2 |
| InChIKey | GTYNLUYLVAHRSP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |