C16H13N3O — CID 14423224
2-phenyl-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one (PubChem CID 14423224) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-phenyl-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one.
| Compound Name | 2-phenyl-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one |
|---|---|
| PubChem CID | 14423224 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-phenyl-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one |
| SMILES | O=c1c2c(n(-c3ccccc3)c3nccnc13)CCC2 |
| InChI | InChI=1S/C16H13N3O/c20-15-12-7-4-8-13(12)19(11-5-2-1-3-6-11)16-14(15)17-9-10-18-16/h1-3,5-6,9-10H,4,7-8H2 |
| InChIKey | QPBWEBKPRCFIDP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |