C20H16FN3O4 — CID 14423608
1-[7-fluoro-3-oxo-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-6-yl]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 14423608) has the molecular formula C20H16FN3O4 and a molecular weight of 381.36 g/mol. Its IUPAC name is 1-[7-fluoro-3-oxo-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-6-yl]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[7-fluoro-3-oxo-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-6-yl]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 14423608 |
| Molecular Formula | C20H16FN3O4 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-[7-fluoro-3-oxo-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-6-yl]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(c2cc3c(cc2F)OCC(=O)N3Cc2ccccn2)C1=O |
| InChI | InChI=1S/C20H16FN3O4/c1-11-12(2)20(27)24(19(11)26)15-8-16-17(7-14(15)21)28-10-18(25)23(16)9-13-5-3-4-6-22-13/h3-8H,9-10H2,1-2H3 |
| InChIKey | QWVNSUOEBUGWKR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|