About [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate
[1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate (PubChem CID 14424205) has the molecular formula C20H19F3O4
and a molecular weight of 380.36 g/mol. Its IUPAC name is [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate.
Molecular Properties
| Compound Name | [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate |
| PubChem CID | 14424205 |
| Molecular Formula | C20H19F3O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate |
| SMILES | CC(=O)OC1=C(CC2CCCC(C(F)(F)F)C2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H19F3O4/c1-11(24)27-19-16(10-12-5-4-6-13(9-12)20(21,22)23)17(25)14-7-2-3-8-15(14)18(19)26/h2-3,7-8,12-13H,4-6,9-10H2,1H3 |
| InChIKey | RYNDBCBIXHFREF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate?
The IUPAC name of [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate (CID 14424205) is [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate.
What is the SMILES notation for [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate?
The canonical SMILES for [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate is CC(=O)OC1=C(CC2CCCC(C(F)(F)F)C2)C(=O)c2ccccc2C1=O.
What is the InChIKey of [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate?
The InChIKey is RYNDBCBIXHFREF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F3O4/c1-11(24)27-19-16(10-12-5-4-6-13(9-12)20(21,22)23)17(25)14-7-2-3-8-15(14)18(19)26/h2-3,7-8,12-13H,4-6,9-10H2,1H3.
What are the key properties of [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate?
[1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate has a molecular weight of 380.36 g/mol, XLogP of 4.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4-dioxo-3-[[3-(trifluoromethyl)cyclohexyl]methyl]naphthalen-2-yl] acetate is sourced from PubChem (CID 14424205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).