About N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium
N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 14424417) has the molecular formula C10H24N2OS2
and a molecular weight of 252.45 g/mol. Its IUPAC name is N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 14424417 |
| Molecular Formula | C10H24N2OS2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CCN(CC)C(=S)[S-].C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C5H11NS2/c1-6(2,3)4-5-7;1-3-6(4-2)5(7)8/h7H,4-5H2,1-3H3;3-4H2,1-2H3,(H,7,8)/q+1;/p-1 |
| InChIKey | FKXHNRQWEOPEDC-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium (CID 14424417) is N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium is CCN(CC)C(=S)[S-].C[N+](C)(C)CCO.
What is the InChIKey of N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is FKXHNRQWEOPEDC-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H14NO.C5H11NS2/c1-6(2,3)4-5-7;1-3-6(4-2)5(7)8/h7H,4-5H2,1-3H3;3-4H2,1-2H3,(H,7,8)/q+1;/p-1.
What are the key properties of N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium?
N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 252.45 g/mol, XLogP of 0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylcarbamodithioate;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 14424417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).