About methyl 4-(benzylamino)benzoate
methyl 4-(benzylamino)benzoate (PubChem CID 14425149) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is methyl 4-(benzylamino)benzoate.
Molecular Properties
| Compound Name | methyl 4-(benzylamino)benzoate |
| PubChem CID | 14425149 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | methyl 4-(benzylamino)benzoate |
| SMILES | COC(=O)c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H15NO2/c1-18-15(17)13-7-9-14(10-8-13)16-11-12-5-3-2-4-6-12/h2-10,16H,11H2,1H3 |
| InChIKey | LFUBRMQHWKUBDF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-(benzylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(benzylamino)benzoate?
The IUPAC name of methyl 4-(benzylamino)benzoate (CID 14425149) is methyl 4-(benzylamino)benzoate.
What is the SMILES notation for methyl 4-(benzylamino)benzoate?
The canonical SMILES for methyl 4-(benzylamino)benzoate is COC(=O)c1ccc(NCc2ccccc2)cc1.
What is the InChIKey of methyl 4-(benzylamino)benzoate?
The InChIKey is LFUBRMQHWKUBDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-18-15(17)13-7-9-14(10-8-13)16-11-12-5-3-2-4-6-12/h2-10,16H,11H2,1H3.
What are the key properties of methyl 4-(benzylamino)benzoate?
methyl 4-(benzylamino)benzoate has a molecular weight of 241.29 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(benzylamino)benzoate is sourced from PubChem (CID 14425149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).