About 5-methylpyridine-2,3-dicarboxylic acid
5-methylpyridine-2,3-dicarboxylic acid (PubChem CID 14425308) has the molecular formula C8H7NO4
and a molecular weight of 181.15 g/mol. Its IUPAC name is 5-methylpyridine-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-methylpyridine-2,3-dicarboxylic acid |
| PubChem CID | 14425308 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 5-methylpyridine-2,3-dicarboxylic acid |
| SMILES | Cc1cnc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C8H7NO4/c1-4-2-5(7(10)11)6(8(12)13)9-3-4/h2-3H,1H3,(H,10,11)(H,12,13) |
| InChIKey | JPIJMXOJEHMTPU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylpyridine-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyridine-2,3-dicarboxylic acid?
The IUPAC name of 5-methylpyridine-2,3-dicarboxylic acid (CID 14425308) is 5-methylpyridine-2,3-dicarboxylic acid.
What is the SMILES notation for 5-methylpyridine-2,3-dicarboxylic acid?
The canonical SMILES for 5-methylpyridine-2,3-dicarboxylic acid is Cc1cnc(C(=O)O)c(C(=O)O)c1.
What is the InChIKey of 5-methylpyridine-2,3-dicarboxylic acid?
The InChIKey is JPIJMXOJEHMTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c1-4-2-5(7(10)11)6(8(12)13)9-3-4/h2-3H,1H3,(H,10,11)(H,12,13).
What are the key properties of 5-methylpyridine-2,3-dicarboxylic acid?
5-methylpyridine-2,3-dicarboxylic acid has a molecular weight of 181.15 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyridine-2,3-dicarboxylic acid is sourced from PubChem (CID 14425308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).