C29H32 — CID 14425582
1,1,4,4-tetramethyl-6-[(E)-1-(4-phenylphenyl)prop-1-en-2-yl]-2,3-dihydronaphthalene (PubChem CID 14425582) has the molecular formula C29H32 and a molecular weight of 380.58 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-6-[(E)-1-(4-phenylphenyl)prop-1-en-2-yl]-2,3-dihydronaphthalene.
| Compound Name | 1,1,4,4-tetramethyl-6-[(E)-1-(4-phenylphenyl)prop-1-en-2-yl]-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 14425582 |
| Molecular Formula | C29H32 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 1,1,4,4-tetramethyl-6-[(E)-1-(4-phenylphenyl)prop-1-en-2-yl]-2,3-dihydronaphthalene |
| SMILES | C/C(=C\c1ccc(-c2ccccc2)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H32/c1-21(19-22-11-13-24(14-12-22)23-9-7-6-8-10-23)25-15-16-26-27(20-25)29(4,5)18-17-28(26,2)3/h6-16,19-20H,17-18H2,1-5H3/b21-19+ |
| InChIKey | GYFMFFUGHGQSIH-XUTLUUPISA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|