About 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol
2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol (PubChem CID 14425906) has the molecular formula C16H13NO2S
and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol |
| PubChem CID | 14425906 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol |
| SMILES | COc1ccc(-c2nc(O)c(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C16H13NO2S/c1-19-13-9-7-12(8-10-13)16-17-15(18)14(20-16)11-5-3-2-4-6-11/h2-10,18H,1H3 |
| InChIKey | YQAKORGQQCUKEJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol?
The IUPAC name of 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol (CID 14425906) is 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol.
What is the SMILES notation for 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol?
The canonical SMILES for 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol is COc1ccc(-c2nc(O)c(-c3ccccc3)s2)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol?
The InChIKey is YQAKORGQQCUKEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2S/c1-19-13-9-7-12(8-10-13)16-17-15(18)14(20-16)11-5-3-2-4-6-11/h2-10,18H,1H3.
What are the key properties of 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol?
2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol has a molecular weight of 283.35 g/mol, XLogP of 4.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-5-phenyl-1,3-thiazol-4-ol is sourced from PubChem (CID 14425906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).