About (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone
(3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 1442723) has the molecular formula C21H17N3OS
and a molecular weight of 359.45 g/mol. Its IUPAC name is (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone.
Molecular Properties
| Compound Name | (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone |
| PubChem CID | 1442723 |
| Molecular Formula | C21H17N3OS |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | Cc1cccc2cc3c(N)c(C(=O)N4CCc5ccccc54)sc3nc12 |
| InChI | InChI=1S/C21H17N3OS/c1-12-5-4-7-14-11-15-17(22)19(26-20(15)23-18(12)14)21(25)24-10-9-13-6-2-3-8-16(13)24/h2-8,11H,9-10,22H2,1H3 |
| InChIKey | SHEIJKBDSFBYIO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone?
The IUPAC name of (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone (CID 1442723) is (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone.
What is the SMILES notation for (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone?
The canonical SMILES for (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone is Cc1cccc2cc3c(N)c(C(=O)N4CCc5ccccc54)sc3nc12.
What is the InChIKey of (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone?
The InChIKey is SHEIJKBDSFBYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3OS/c1-12-5-4-7-14-11-15-17(22)19(26-20(15)23-18(12)14)21(25)24-10-9-13-6-2-3-8-16(13)24/h2-8,11H,9-10,22H2,1H3.
What are the key properties of (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone?
(3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone has a molecular weight of 359.45 g/mol, XLogP of 4.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-8-methylthieno[2,3-b]quinolin-2-yl)-(2,3-dihydroindol-1-yl)methanone is sourced from PubChem (CID 1442723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).