C18H18O7 — CID 14427389
5,8-dihydroxy-3-[(4-hydroxyphenyl)methyl]-6,7-dimethoxy-2,3-dihydrochromen-4-one (PubChem CID 14427389) has the molecular formula C18H18O7 and a molecular weight of 346.33 g/mol. Its IUPAC name is 5,8-dihydroxy-3-[(4-hydroxyphenyl)methyl]-6,7-dimethoxy-2,3-dihydrochromen-4-one.
| Compound Name | 5,8-dihydroxy-3-[(4-hydroxyphenyl)methyl]-6,7-dimethoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 14427389 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 5,8-dihydroxy-3-[(4-hydroxyphenyl)methyl]-6,7-dimethoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1c(O)c2c(c(O)c1OC)C(=O)C(Cc1ccc(O)cc1)CO2 |
| InChI | InChI=1S/C18H18O7/c1-23-17-14(21)12-13(20)10(7-9-3-5-11(19)6-4-9)8-25-16(12)15(22)18(17)24-2/h3-6,10,19,21-22H,7-8H2,1-2H3 |
| InChIKey | PGCPWPPPMWXCMG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|