C15H21NO — CID 14427404
(2E,4E,6Z)-1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4,6-trien-1-one (PubChem CID 14427404) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (2E,4E,6Z)-1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4,6-trien-1-one.
| Compound Name | (2E,4E,6Z)-1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 14427404 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (2E,4E,6Z)-1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4,6-trien-1-one |
| SMILES | CCC/C=C\C=C\C=C\C(=O)N1C=CCCC1 |
| InChI | InChI=1S/C15H21NO/c1-2-3-4-5-6-7-9-12-15(17)16-13-10-8-11-14-16/h4-7,9-10,12-13H,2-3,8,11,14H2,1H3/b5-4-,7-6+,12-9+ |
| InChIKey | MYQLSFPPFMXWEZ-PXUSDECGSA-N |
| XLogP | 3.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|