C15H23NO — CID 14427414
(2E,4E,8Z)-1-piperidin-1-yldeca-2,4,8-trien-1-one (PubChem CID 14427414) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (2E,4E,8Z)-1-piperidin-1-yldeca-2,4,8-trien-1-one.
| Compound Name | (2E,4E,8Z)-1-piperidin-1-yldeca-2,4,8-trien-1-one |
|---|---|
| PubChem CID | 14427414 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2E,4E,8Z)-1-piperidin-1-yldeca-2,4,8-trien-1-one |
| SMILES | C/C=C\CC/C=C/C=C/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H23NO/c1-2-3-4-5-6-7-9-12-15(17)16-13-10-8-11-14-16/h2-3,6-7,9,12H,4-5,8,10-11,13-14H2,1H3/b3-2-,7-6+,12-9+ |
| InChIKey | KCDOVRRODRAKCG-AMJQMGDOSA-N |
| XLogP | 3.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|