C34H36N2O5 — CID 14428702
(5R,6R,7S,8R)-6,7,8-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-4-oxa-1,2-diazaspiro[2.5]octane (PubChem CID 14428702) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is (5R,6R,7S,8R)-6,7,8-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-4-oxa-1,2-diazaspiro[2.5]octane.
| Compound Name | (5R,6R,7S,8R)-6,7,8-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-4-oxa-1,2-diazaspiro[2.5]octane |
|---|---|
| PubChem CID | 14428702 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | (5R,6R,7S,8R)-6,7,8-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-4-oxa-1,2-diazaspiro[2.5]octane |
| SMILES | c1ccc(COC[C@H]2OC3(NN3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H36N2O5/c1-5-13-26(14-6-1)21-37-25-30-31(38-22-27-15-7-2-8-16-27)32(39-23-28-17-9-3-10-18-28)33(34(41-30)35-36-34)40-24-29-19-11-4-12-20-29/h1-20,30-33,35-36H,21-25H2/t30-,31-,32+,33-/m1/s1 |
| InChIKey | OJJWKAQBZNCYSH-NXVJRICRSA-N |
| XLogP | 5.12 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|