C10H16O3 — CID 14429286
spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-ol (PubChem CID 14429286) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-ol.
| Compound Name | spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-ol |
|---|---|
| PubChem CID | 14429286 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-ol |
| SMILES | OC1CCC2CC3(CC12)OCCO3 |
| InChI | InChI=1S/C10H16O3/c11-9-2-1-7-5-10(6-8(7)9)12-3-4-13-10/h7-9,11H,1-6H2 |
| InChIKey | GEFCAENEWYJNRM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |