C13H10O3 — CID 14429408
3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),7,9-pentaen-11-one (PubChem CID 14429408) has the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),7,9-pentaen-11-one.
| Compound Name | 3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),7,9-pentaen-11-one |
|---|---|
| PubChem CID | 14429408 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),7,9-pentaen-11-one |
| SMILES | Cc1cc2cc(=O)cc3oc(C)cc(o1)c23 |
| InChI | InChI=1S/C13H10O3/c1-7-3-9-5-10(14)6-12-13(9)11(15-7)4-8(2)16-12/h3-6H,1-2H3 |
| InChIKey | XMBHPPIZLUISDL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |