About 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol
7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol (PubChem CID 14430944) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol.
Molecular Properties
| Compound Name | 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol |
| PubChem CID | 14430944 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol |
| SMILES | COC1C(O)C2C=CC(O)C1N2C |
| InChI | InChI=1S/C9H15NO3/c1-10-5-3-4-6(11)7(10)9(13-2)8(5)12/h3-9,11-12H,1-2H3 |
| InChIKey | ZEEICHNLNDBBCQ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol?
The IUPAC name of 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol (CID 14430944) is 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol.
What is the SMILES notation for 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol?
The canonical SMILES for 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol is COC1C(O)C2C=CC(O)C1N2C.
What is the InChIKey of 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol?
The InChIKey is ZEEICHNLNDBBCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-10-5-3-4-6(11)7(10)9(13-2)8(5)12/h3-9,11-12H,1-2H3.
What are the key properties of 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol?
7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol has a molecular weight of 185.22 g/mol, XLogP of -1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-8-methyl-8-azabicyclo[3.2.1]oct-3-ene-2,6-diol is sourced from PubChem (CID 14430944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).