C11H9Cl2NO — CID 14431148
2-(3,5-dichloro-2-methoxyphenyl)-1H-pyrrole (PubChem CID 14431148) has the molecular formula C11H9Cl2NO and a molecular weight of 242.11 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-methoxyphenyl)-1H-pyrrole.
| Compound Name | 2-(3,5-dichloro-2-methoxyphenyl)-1H-pyrrole |
|---|---|
| PubChem CID | 14431148 |
| Molecular Formula | C11H9Cl2NO |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-(3,5-dichloro-2-methoxyphenyl)-1H-pyrrole |
| SMILES | COc1c(Cl)cc(Cl)cc1-c1ccc[nH]1 |
| InChI | InChI=1S/C11H9Cl2NO/c1-15-11-8(10-3-2-4-14-10)5-7(12)6-9(11)13/h2-6,14H,1H3 |
| InChIKey | JEEMPCKNKFKDOD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |