C11H6Br3Cl2NO — CID 14431154
2,3,4-tribromo-5-(3,5-dichloro-2-methoxyphenyl)-1H-pyrrole (PubChem CID 14431154) has the molecular formula C11H6Br3Cl2NO and a molecular weight of 478.79 g/mol. Its IUPAC name is 2,3,4-tribromo-5-(3,5-dichloro-2-methoxyphenyl)-1H-pyrrole.
| Compound Name | 2,3,4-tribromo-5-(3,5-dichloro-2-methoxyphenyl)-1H-pyrrole |
|---|---|
| PubChem CID | 14431154 |
| Molecular Formula | C11H6Br3Cl2NO |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 474.74 |
| IUPAC Name | 2,3,4-tribromo-5-(3,5-dichloro-2-methoxyphenyl)-1H-pyrrole |
| SMILES | COc1c(Cl)cc(Cl)cc1-c1[nH]c(Br)c(Br)c1Br |
| InChI | InChI=1S/C11H6Br3Cl2NO/c1-18-10-5(2-4(15)3-6(10)16)9-7(12)8(13)11(14)17-9/h2-3,17H,1H3 |
| InChIKey | YBGXWOMQZZTNON-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |