C27H48O8 — CID 14432448
(1S,2R,4R,5R,9S,10R,13R,14R,15R,19S,20S)-13-ethyl-4,14-dihydroxy-2,4,7,7,10,14,17,17,19,20-decamethyl-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 14432448) has the molecular formula C27H48O8 and a molecular weight of 500.67 g/mol. Its IUPAC name is (1S,2R,4R,5R,9S,10R,13R,14R,15R,19S,20S)-13-ethyl-4,14-dihydroxy-2,4,7,7,10,14,17,17,19,20-decamethyl-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1S,2R,4R,5R,9S,10R,13R,14R,15R,19S,20S)-13-ethyl-4,14-dihydroxy-2,4,7,7,10,14,17,17,19,20-decamethyl-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 14432448 |
| Molecular Formula | C27H48O8 |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | (1S,2R,4R,5R,9S,10R,13R,14R,15R,19S,20S)-13-ethyl-4,14-dihydroxy-2,4,7,7,10,14,17,17,19,20-decamethyl-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@H]2OC(C)(C)O[C@H]([C@H]2C)[C@](C)(O)C[C@@H](C)[C@@H]2OC(C)(C)O[C@H]([C@H]2C)[C@]1(C)O |
| InChI | InChI=1S/C27H48O8/c1-12-18-27(11,30)22-15(3)19(32-24(6,7)35-22)14(2)13-26(10,29)21-16(4)20(17(5)23(28)31-18)33-25(8,9)34-21/h14-22,29-30H,12-13H2,1-11H3/t14-,15+,16+,17-,18-,19+,20+,21-,22-,26-,27-/m1/s1 |
| InChIKey | LHVLFTDXJAMSTR-XYLWCJITSA-N |
| XLogP | 3.80 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |