C11H20O — CID 14432938
[(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]methanol (PubChem CID 14432938) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is [(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]methanol.
| Compound Name | [(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 14432938 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | [(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]methanol |
| SMILES | CC1=CC[C@@H](C)C(C)(C)[C@@H]1CO |
| InChI | InChI=1S/C11H20O/c1-8-5-6-9(2)11(3,4)10(8)7-12/h5,9-10,12H,6-7H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | PKBSWHCLRBAHEE-NXEZZACHSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|