C10H7F13O — CID 14433679
8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane (PubChem CID 14433679) has the molecular formula C10H7F13O and a molecular weight of 390.14 g/mol. Its IUPAC name is 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane.
| Compound Name | 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane |
|---|---|
| PubChem CID | 14433679 |
| Molecular Formula | C10H7F13O |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane |
| SMILES | C=COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F13O/c1-2-24-4-3-5(11,12)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h2H,1,3-4H2 |
| InChIKey | CJPSFIYLTINNQG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|