About 1,10-phenanthroline-4,7-dicarbaldehyde
1,10-phenanthroline-4,7-dicarbaldehyde (PubChem CID 14434082) has the molecular formula C14H8N2O2
and a molecular weight of 236.23 g/mol. Its IUPAC name is 1,10-phenanthroline-4,7-dicarbaldehyde.
Molecular Properties
| Compound Name | 1,10-phenanthroline-4,7-dicarbaldehyde |
| PubChem CID | 14434082 |
| Molecular Formula | C14H8N2O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1,10-phenanthroline-4,7-dicarbaldehyde |
| SMILES | O=Cc1ccnc2c1ccc1c(C=O)ccnc12 |
| InChI | InChI=1S/C14H8N2O2/c17-7-9-3-5-15-13-11(9)1-2-12-10(8-18)4-6-16-14(12)13/h1-8H |
| InChIKey | HCJOBZLFARGFLG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,10-phenanthroline-4,7-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-phenanthroline-4,7-dicarbaldehyde?
The IUPAC name of 1,10-phenanthroline-4,7-dicarbaldehyde (CID 14434082) is 1,10-phenanthroline-4,7-dicarbaldehyde.
What is the SMILES notation for 1,10-phenanthroline-4,7-dicarbaldehyde?
The canonical SMILES for 1,10-phenanthroline-4,7-dicarbaldehyde is O=Cc1ccnc2c1ccc1c(C=O)ccnc12.
What is the InChIKey of 1,10-phenanthroline-4,7-dicarbaldehyde?
The InChIKey is HCJOBZLFARGFLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O2/c17-7-9-3-5-15-13-11(9)1-2-12-10(8-18)4-6-16-14(12)13/h1-8H.
What are the key properties of 1,10-phenanthroline-4,7-dicarbaldehyde?
1,10-phenanthroline-4,7-dicarbaldehyde has a molecular weight of 236.23 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-phenanthroline-4,7-dicarbaldehyde is sourced from PubChem (CID 14434082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).