About 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one
5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one (PubChem CID 14434458) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one.
Molecular Properties
| Compound Name | 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one |
| PubChem CID | 14434458 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one |
| SMILES | CCOC1=CC(C)(C)C(OC)OC1=O |
| InChI | InChI=1S/C10H16O4/c1-5-13-7-6-10(2,3)9(12-4)14-8(7)11/h6,9H,5H2,1-4H3 |
| InChIKey | TYVFMXAHCAEEPF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one?
The IUPAC name of 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one (CID 14434458) is 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one.
What is the SMILES notation for 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one?
The canonical SMILES for 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one is CCOC1=CC(C)(C)C(OC)OC1=O.
What is the InChIKey of 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one?
The InChIKey is TYVFMXAHCAEEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-5-13-7-6-10(2,3)9(12-4)14-8(7)11/h6,9H,5H2,1-4H3.
What are the key properties of 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one?
5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one has a molecular weight of 200.23 g/mol, XLogP of 1.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-2-methoxy-3,3-dimethyl-2H-pyran-6-one is sourced from PubChem (CID 14434458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).