C18H33N3O6 — CID 14434736
ethyl 2-[4,7-bis(2-ethoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]acetate (PubChem CID 14434736) has the molecular formula C18H33N3O6 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl 2-[4,7-bis(2-ethoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]acetate.
| Compound Name | ethyl 2-[4,7-bis(2-ethoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]acetate |
|---|---|
| PubChem CID | 14434736 |
| Molecular Formula | C18H33N3O6 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | ethyl 2-[4,7-bis(2-ethoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CC(=O)OCC)CCN(CC(=O)OCC)CC1 |
| InChI | InChI=1S/C18H33N3O6/c1-4-25-16(22)13-19-7-9-20(14-17(23)26-5-2)11-12-21(10-8-19)15-18(24)27-6-3/h4-15H2,1-3H3 |
| InChIKey | IRVRVUUQWTXPTI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|