About decyl N-methylcarbamate
decyl N-methylcarbamate (PubChem CID 14435660) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is decyl N-methylcarbamate.
Molecular Properties
| Compound Name | decyl N-methylcarbamate |
| PubChem CID | 14435660 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | decyl N-methylcarbamate |
| SMILES | CCCCCCCCCCOC(=O)NC |
| InChI | InChI=1S/C12H25NO2/c1-3-4-5-6-7-8-9-10-11-15-12(14)13-2/h3-11H2,1-2H3,(H,13,14) |
| InChIKey | BGILCZPKYGSHNZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl N-methylcarbamate?
The IUPAC name of decyl N-methylcarbamate (CID 14435660) is decyl N-methylcarbamate.
What is the SMILES notation for decyl N-methylcarbamate?
The canonical SMILES for decyl N-methylcarbamate is CCCCCCCCCCOC(=O)NC.
What is the InChIKey of decyl N-methylcarbamate?
The InChIKey is BGILCZPKYGSHNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-3-4-5-6-7-8-9-10-11-15-12(14)13-2/h3-11H2,1-2H3,(H,13,14).
What are the key properties of decyl N-methylcarbamate?
decyl N-methylcarbamate has a molecular weight of 215.34 g/mol, XLogP of 3.48, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decyl N-methylcarbamate is sourced from PubChem (CID 14435660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).