About 1-benzyl-4,5-dimethylpyrrolidin-2-one
1-benzyl-4,5-dimethylpyrrolidin-2-one (PubChem CID 14435952) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-benzyl-4,5-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-benzyl-4,5-dimethylpyrrolidin-2-one |
| PubChem CID | 14435952 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-benzyl-4,5-dimethylpyrrolidin-2-one |
| SMILES | CC1CC(=O)N(Cc2ccccc2)C1C |
| InChI | InChI=1S/C13H17NO/c1-10-8-13(15)14(11(10)2)9-12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | PTHAPSURRKRDJB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-4,5-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4,5-dimethylpyrrolidin-2-one?
The IUPAC name of 1-benzyl-4,5-dimethylpyrrolidin-2-one (CID 14435952) is 1-benzyl-4,5-dimethylpyrrolidin-2-one.
What is the SMILES notation for 1-benzyl-4,5-dimethylpyrrolidin-2-one?
The canonical SMILES for 1-benzyl-4,5-dimethylpyrrolidin-2-one is CC1CC(=O)N(Cc2ccccc2)C1C.
What is the InChIKey of 1-benzyl-4,5-dimethylpyrrolidin-2-one?
The InChIKey is PTHAPSURRKRDJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-10-8-13(15)14(11(10)2)9-12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3.
What are the key properties of 1-benzyl-4,5-dimethylpyrrolidin-2-one?
1-benzyl-4,5-dimethylpyrrolidin-2-one has a molecular weight of 203.29 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4,5-dimethylpyrrolidin-2-one is sourced from PubChem (CID 14435952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).