About 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine
1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine (PubChem CID 144372382) has the molecular formula C14H24FNO
and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine.
Molecular Properties
| Compound Name | 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine |
| PubChem CID | 144372382 |
| Molecular Formula | C14H24FNO |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine |
| SMILES | CC/C=C(\C(=C(/C)\OC)\CN1CCCCC1)/F |
| InChI | InChI=1S/C14H24FNO/c1-4-8-14(15)13(12(2)17-3)11-16-9-6-5-7-10-16/h8H,4-7,9-11H2,1-3H3/b13-12+,14-8+ |
| InChIKey | CEZJTIMTOJFOPW-BPFWAFMNSA-N |
| XLogP | 3.30 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | 291 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine?
The IUPAC name of 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine (CID 144372382) is 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine.
What is the SMILES notation for 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine?
The canonical SMILES for 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine is CC/C=C(\C(=C(/C)\OC)\CN1CCCCC1)/F.
What is the InChIKey of 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine?
The InChIKey is CEZJTIMTOJFOPW-BPFWAFMNSA-N. The full InChI is InChI=1S/C14H24FNO/c1-4-8-14(15)13(12(2)17-3)11-16-9-6-5-7-10-16/h8H,4-7,9-11H2,1-3H3/b13-12+,14-8+.
What are the key properties of 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine?
1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine has a molecular weight of 241.34 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E,2E)-3-fluoro-2-(1-methoxyethylidene)hex-3-enyl]piperidine is sourced from PubChem (CID 144372382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).