C10H12O2 — CID 14440163
1,2,3,4-tetrahydronaphthalene-1,4-diol (PubChem CID 14440163) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalene-1,4-diol.
| Compound Name | 1,2,3,4-tetrahydronaphthalene-1,4-diol |
|---|---|
| PubChem CID | 14440163 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalene-1,4-diol |
| SMILES | OC1CCC(O)c2ccccc21 |
| InChI | InChI=1S/C10H12O2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-4,9-12H,5-6H2 |
| InChIKey | FTCMTZXWNUAYHT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |