C10H14 — CID 14440263
7-methyl-4,5,6,7-tetrahydro-1H-indene (PubChem CID 14440263) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is 7-methyl-4,5,6,7-tetrahydro-1H-indene.
| Compound Name | 7-methyl-4,5,6,7-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 14440263 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 7-methyl-4,5,6,7-tetrahydro-1H-indene |
| SMILES | CC1CCCC2=C1CC=C2 |
| InChI | InChI=1S/C10H14/c1-8-4-2-5-9-6-3-7-10(8)9/h3,6,8H,2,4-5,7H2,1H3 |
| InChIKey | QDHSYAMSWIATMD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |