C12H20S — CID 14440857
1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene (PubChem CID 14440857) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is 1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene.
| Compound Name | 1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene |
|---|---|
| PubChem CID | 14440857 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene |
| SMILES | C1CCC2C(C1)SC1CCCCC12 |
| InChI | InChI=1S/C12H20S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h9-12H,1-8H2 |
| InChIKey | XMJFSCXZDZSDJS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |