About copper bis(N,N-diethylcarbamothioate)
copper bis(N,N-diethylcarbamothioate) (PubChem CID 14440902) has the molecular formula C10H20CuN2O2S2
and a molecular weight of 327.96 g/mol. Its IUPAC name is copper bis(N,N-diethylcarbamothioate).
Molecular Properties
| Compound Name | copper bis(N,N-diethylcarbamothioate) |
| PubChem CID | 14440902 |
| Molecular Formula | C10H20CuN2O2S2 |
| Molecular Weight | 327.96 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | copper bis(N,N-diethylcarbamothioate) |
| SMILES | CCN(CC)C(=O)[S-].CCN(CC)C(=O)[S-].[Cu+2] |
| InChI | InChI=1S/2C5H11NOS.Cu/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | AOCVYGOOGDPZHR-UHFFFAOYSA-L |
| XLogP | 1.99 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.96 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze copper bis(N,N-diethylcarbamothioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(N,N-diethylcarbamothioate)?
The IUPAC name of copper bis(N,N-diethylcarbamothioate) (CID 14440902) is copper bis(N,N-diethylcarbamothioate).
What is the SMILES notation for copper bis(N,N-diethylcarbamothioate)?
The canonical SMILES for copper bis(N,N-diethylcarbamothioate) is CCN(CC)C(=O)[S-].CCN(CC)C(=O)[S-].[Cu+2].
What is the InChIKey of copper bis(N,N-diethylcarbamothioate)?
The InChIKey is AOCVYGOOGDPZHR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H11NOS.Cu/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2.
What are the key properties of copper bis(N,N-diethylcarbamothioate)?
copper bis(N,N-diethylcarbamothioate) has a molecular weight of 327.96 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(N,N-diethylcarbamothioate) is sourced from PubChem (CID 14440902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).