About [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate
[2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate (PubChem CID 14441087) has the molecular formula C19H21N3O4S
and a molecular weight of 387.46 g/mol. Its IUPAC name is [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate.
Molecular Properties
| Compound Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate |
| PubChem CID | 14441087 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate |
| SMILES | COc1c(C)cnc(CS(=O)c2nc3ccccc3n2COC(C)=O)c1C |
| InChI | InChI=1S/C19H21N3O4S/c1-12-9-20-16(13(2)18(12)25-4)10-27(24)19-21-15-7-5-6-8-17(15)22(19)11-26-14(3)23/h5-9H,10-11H2,1-4H3 |
| InChIKey | SKKQQEZFYKPUOQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate?
The IUPAC name of [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate (CID 14441087) is [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate.
What is the SMILES notation for [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate?
The canonical SMILES for [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate is COc1c(C)cnc(CS(=O)c2nc3ccccc3n2COC(C)=O)c1C.
What is the InChIKey of [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate?
The InChIKey is SKKQQEZFYKPUOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4S/c1-12-9-20-16(13(2)18(12)25-4)10-27(24)19-21-15-7-5-6-8-17(15)22(19)11-26-14(3)23/h5-9H,10-11H2,1-4H3.
What are the key properties of [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate?
[2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate has a molecular weight of 387.46 g/mol, XLogP of 2.89, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-yl]methyl acetate is sourced from PubChem (CID 14441087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).