C9H18NO+ — CID 14442230
4-(methoxymethyl)-1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium (PubChem CID 14442230) has the molecular formula C9H18NO+ and a molecular weight of 156.25 g/mol. Its IUPAC name is 4-(methoxymethyl)-1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium.
| Compound Name | 4-(methoxymethyl)-1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 14442230 |
| Molecular Formula | C9H18NO+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 4-(methoxymethyl)-1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium |
| SMILES | COCC1=CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C9H18NO/c1-10(2)6-4-9(5-7-10)8-11-3/h4H,5-8H2,1-3H3/q+1 |
| InChIKey | SEKLADBUYUZEJO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|