C10H20INS — CID 14442231
4-(ethylsulfanylmethyl)-1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium iodide (PubChem CID 14442231) has the molecular formula C10H20INS and a molecular weight of 313.25 g/mol. Its IUPAC name is 4-(ethylsulfanylmethyl)-1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium iodide.
| Compound Name | 4-(ethylsulfanylmethyl)-1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium iodide |
|---|---|
| PubChem CID | 14442231 |
| Molecular Formula | C10H20INS |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-(ethylsulfanylmethyl)-1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium iodide |
| SMILES | CCSCC1=CC[N+](C)(C)CC1.[I-] |
| InChI | InChI=1S/C10H20NS.HI/c1-4-12-9-10-5-7-11(2,3)8-6-10;/h5H,4,6-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KPMCHPCYTKFWIA-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|