About 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide
2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide (PubChem CID 14442298) has the molecular formula C13H23N3OS2
and a molecular weight of 301.48 g/mol. Its IUPAC name is 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide.
Molecular Properties
| Compound Name | 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide |
| PubChem CID | 14442298 |
| Molecular Formula | C13H23N3OS2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide |
| SMILES | CCN(CC)C(=O)C1(C#N)SCC(CN(C)C)CS1 |
| InChI | InChI=1S/C13H23N3OS2/c1-5-16(6-2)12(17)13(10-14)18-8-11(9-19-13)7-15(3)4/h11H,5-9H2,1-4H3 |
| InChIKey | AGKPTFFYTDRXCH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide?
The IUPAC name of 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide (CID 14442298) is 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide.
What is the SMILES notation for 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide?
The canonical SMILES for 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide is CCN(CC)C(=O)C1(C#N)SCC(CN(C)C)CS1.
What is the InChIKey of 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide?
The InChIKey is AGKPTFFYTDRXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3OS2/c1-5-16(6-2)12(17)13(10-14)18-8-11(9-19-13)7-15(3)4/h11H,5-9H2,1-4H3.
What are the key properties of 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide?
2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide has a molecular weight of 301.48 g/mol, XLogP of 1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-5-[(dimethylamino)methyl]-N,N-diethyl-1,3-dithiane-2-carboxamide is sourced from PubChem (CID 14442298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).