About 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide
3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide (PubChem CID 14442301) has the molecular formula C6H11Br2NO
and a molecular weight of 272.97 g/mol. Its IUPAC name is 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide |
| PubChem CID | 14442301 |
| Molecular Formula | C6H11Br2NO |
| Molecular Weight | 272.97 g/mol |
| Exact Mass | 270.92 |
| IUPAC Name | 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)C(CBr)CBr |
| InChI | InChI=1S/C6H11Br2NO/c1-9(2)6(10)5(3-7)4-8/h5H,3-4H2,1-2H3 |
| InChIKey | GFQLVZNRPDWMKD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.97 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide?
The IUPAC name of 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide (CID 14442301) is 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide.
What is the SMILES notation for 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide?
The canonical SMILES for 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide is CN(C)C(=O)C(CBr)CBr.
What is the InChIKey of 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide?
The InChIKey is GFQLVZNRPDWMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11Br2NO/c1-9(2)6(10)5(3-7)4-8/h5H,3-4H2,1-2H3.
What are the key properties of 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide?
3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide has a molecular weight of 272.97 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(bromomethyl)-N,N-dimethylpropanamide is sourced from PubChem (CID 14442301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).