About 1-(dithiolan-3-yl)-N,N-dimethylmethanamine
1-(dithiolan-3-yl)-N,N-dimethylmethanamine (PubChem CID 14442316) has the molecular formula C6H13NS2
and a molecular weight of 163.31 g/mol. Its IUPAC name is 1-(dithiolan-3-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(dithiolan-3-yl)-N,N-dimethylmethanamine |
| PubChem CID | 14442316 |
| Molecular Formula | C6H13NS2 |
| Molecular Weight | 163.31 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 1-(dithiolan-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCSS1 |
| InChI | InChI=1S/C6H13NS2/c1-7(2)5-6-3-4-8-9-6/h6H,3-5H2,1-2H3 |
| InChIKey | LZRILDAWLCYRBD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 1-(dithiolan-3-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dithiolan-3-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(dithiolan-3-yl)-N,N-dimethylmethanamine (CID 14442316) is 1-(dithiolan-3-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(dithiolan-3-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(dithiolan-3-yl)-N,N-dimethylmethanamine is CN(C)CC1CCSS1.
What is the InChIKey of 1-(dithiolan-3-yl)-N,N-dimethylmethanamine?
The InChIKey is LZRILDAWLCYRBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NS2/c1-7(2)5-6-3-4-8-9-6/h6H,3-5H2,1-2H3.
What are the key properties of 1-(dithiolan-3-yl)-N,N-dimethylmethanamine?
1-(dithiolan-3-yl)-N,N-dimethylmethanamine has a molecular weight of 163.31 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dithiolan-3-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 14442316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).